C22H24N2O2 — CID 67377379
1,2-dicyclopropyl-4-(1-phenyl-5-propylpyrazol-4-yl)but-2-ene-1,4-dione (PubChem CID 67377379) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1,2-dicyclopropyl-4-(1-phenyl-5-propylpyrazol-4-yl)but-2-ene-1,4-dione.
| Compound Name | 1,2-dicyclopropyl-4-(1-phenyl-5-propylpyrazol-4-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 67377379 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1,2-dicyclopropyl-4-(1-phenyl-5-propylpyrazol-4-yl)but-2-ene-1,4-dione |
| SMILES | CCCc1c(C(=O)C=C(C(=O)C2CC2)C2CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-2-6-20-19(14-23-24(20)17-7-4-3-5-8-17)21(25)13-18(15-9-10-15)22(26)16-11-12-16/h3-5,7-8,13-16H,2,6,9-12H2,1H3 |
| InChIKey | APFLLIDZJQAETQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|