C24H30N2O — CID 151377204
(2E)-1-(1-phenyl-5-propylpyrazol-4-yl)-2-[(1R,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]ethanone (PubChem CID 151377204) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is (2E)-1-(1-phenyl-5-propylpyrazol-4-yl)-2-[(1R,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]ethanone.
| Compound Name | (2E)-1-(1-phenyl-5-propylpyrazol-4-yl)-2-[(1R,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]ethanone |
|---|---|
| PubChem CID | 151377204 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (2E)-1-(1-phenyl-5-propylpyrazol-4-yl)-2-[(1R,4S)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]ethanone |
| SMILES | CCCc1c(C(=O)/C=C2\C[C@]3(C)CC[C@H]2C3(C)C)cnn1-c1ccccc1 |
| InChI | InChI=1S/C24H30N2O/c1-5-9-21-19(16-25-26(21)18-10-7-6-8-11-18)22(27)14-17-15-24(4)13-12-20(17)23(24,2)3/h6-8,10-11,14,16,20H,5,9,12-13,15H2,1-4H3/b17-14+/t20-,24+/m1/s1 |
| InChIKey | ORQPJWUKRABWJD-XTRLOZDISA-N |
| XLogP | 5.78 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|