C22H24N2O2 — CID 91180811
(1S,4R)-1,7,7-trimethyl-3-[2-(5-methyl-1-phenylpyrazol-4-yl)-2-oxoethylidene]bicyclo[2.2.1]heptan-2-one (PubChem CID 91180811) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (1S,4R)-1,7,7-trimethyl-3-[2-(5-methyl-1-phenylpyrazol-4-yl)-2-oxoethylidene]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4R)-1,7,7-trimethyl-3-[2-(5-methyl-1-phenylpyrazol-4-yl)-2-oxoethylidene]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 91180811 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (1S,4R)-1,7,7-trimethyl-3-[2-(5-methyl-1-phenylpyrazol-4-yl)-2-oxoethylidene]bicyclo[2.2.1]heptan-2-one |
| SMILES | Cc1c(C(=O)C=C2C(=O)[C@@]3(C)CC[C@@H]2C3(C)C)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-14-17(13-23-24(14)15-8-6-5-7-9-15)19(25)12-16-18-10-11-22(4,20(16)26)21(18,2)3/h5-9,12-13,18H,10-11H2,1-4H3/t18-,22+/m0/s1 |
| InChIKey | DAIODOVOHHIUCV-PGRDOPGGSA-N |
| XLogP | 4.32 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|