C16H11N5O2S — CID 67378063
10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-12-carbonitrile (PubChem CID 67378063) has the molecular formula C16H11N5O2S and a molecular weight of 337.36 g/mol. Its IUPAC name is 10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-12-carbonitrile.
| Compound Name | 10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-12-carbonitrile |
|---|---|
| PubChem CID | 67378063 |
| Molecular Formula | C16H11N5O2S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-12-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C#N)c3c4[nH]ncc4cnc32)cc1 |
| InChI | InChI=1S/C16H11N5O2S/c1-10-2-4-13(5-3-10)24(22,23)21-9-11(6-17)14-15-12(8-19-20-15)7-18-16(14)21/h2-5,7-9H,1H3,(H,19,20) |
| InChIKey | BAQCAKRGAIFBNL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |