About 2H-pyran-3-ylcarbamic acid
2H-pyran-3-ylcarbamic acid (PubChem CID 67378136) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 2H-pyran-3-ylcarbamic acid.
Molecular Properties
| Compound Name | 2H-pyran-3-ylcarbamic acid |
| PubChem CID | 67378136 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 2H-pyran-3-ylcarbamic acid |
| SMILES | O=C(O)NC1=CC=COC1 |
| InChI | InChI=1S/C6H7NO3/c8-6(9)7-5-2-1-3-10-4-5/h1-3,7H,4H2,(H,8,9) |
| InChIKey | XDNOUGUXJHJQAA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-pyran-3-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyran-3-ylcarbamic acid?
The IUPAC name of 2H-pyran-3-ylcarbamic acid (CID 67378136) is 2H-pyran-3-ylcarbamic acid.
What is the SMILES notation for 2H-pyran-3-ylcarbamic acid?
The canonical SMILES for 2H-pyran-3-ylcarbamic acid is O=C(O)NC1=CC=COC1.
What is the InChIKey of 2H-pyran-3-ylcarbamic acid?
The InChIKey is XDNOUGUXJHJQAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c8-6(9)7-5-2-1-3-10-4-5/h1-3,7H,4H2,(H,8,9).
What are the key properties of 2H-pyran-3-ylcarbamic acid?
2H-pyran-3-ylcarbamic acid has a molecular weight of 141.13 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyran-3-ylcarbamic acid is sourced from PubChem (CID 67378136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).