C11H14NO5PS — CID 67381769
2-[[hydroxy(phenyl)phosphinothioyl]amino]pentanedioic acid (PubChem CID 67381769) has the molecular formula C11H14NO5PS and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-[[hydroxy(phenyl)phosphinothioyl]amino]pentanedioic acid.
| Compound Name | 2-[[hydroxy(phenyl)phosphinothioyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 67381769 |
| Molecular Formula | C11H14NO5PS |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-[[hydroxy(phenyl)phosphinothioyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NP(O)(=S)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H14NO5PS/c13-10(14)7-6-9(11(15)16)12-18(17,19)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14)(H,15,16)(H2,12,17,19) |
| InChIKey | LAKZHFMZHNJDKO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|