C21H21N5OS — CID 67382340
2-N-(2-methoxyethyl)-5-phenyl-4-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidine-2,4-diamine (PubChem CID 67382340) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-5-phenyl-4-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-5-phenyl-4-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67382340 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-N-(2-methoxyethyl)-5-phenyl-4-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C21H21N5OS/c1-27-12-11-23-21-25-19(24-13-16-9-5-6-10-22-16)18-17(14-28-20(18)26-21)15-7-3-2-4-8-15/h2-10,14H,11-13H2,1H3,(H2,23,24,25,26) |
| InChIKey | QLYOHMOBYPLSKH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|