C24H21N5S — CID 146424626
2-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]-5-phenyl-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 146424626) has the molecular formula C24H21N5S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]-5-phenyl-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]-5-phenyl-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146424626 |
| Molecular Formula | C24H21N5S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]-5-phenyl-N-(pyridin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | C=N/C(=C\C=C/C)c1nc(NCc2ccccn2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C24H21N5S/c1-3-4-13-20(25-2)22-28-23(27-15-18-12-8-9-14-26-18)21-19(16-30-24(21)29-22)17-10-6-5-7-11-17/h3-14,16H,2,15H2,1H3,(H,27,28,29)/b4-3-,20-13- |
| InChIKey | CHPCMOCZLQUTGS-DROOXVMESA-N |
| XLogP | 5.98 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|