C29H24F3N3O3 — CID 67384922
2-[(4-pyridin-2-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrrol-1-ylpropanoic acid (PubChem CID 67384922) has the molecular formula C29H24F3N3O3 and a molecular weight of 519.52 g/mol. Its IUPAC name is 2-[(4-pyridin-2-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrrol-1-ylpropanoic acid.
| Compound Name | 2-[(4-pyridin-2-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrrol-1-ylpropanoic acid |
|---|---|
| PubChem CID | 67384922 |
| Molecular Formula | C29H24F3N3O3 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 2-[(4-pyridin-2-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrrol-1-ylpropanoic acid |
| SMILES | O=C(O)C(Cn1cccc1)N(Cc1ccc(-c2ccccn2)cc1)C(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H24F3N3O3/c30-29(31,32)24-13-8-21(9-14-24)10-15-27(36)35(26(28(37)38)20-34-17-3-4-18-34)19-22-6-11-23(12-7-22)25-5-1-2-16-33-25/h1-18,26H,19-20H2,(H,37,38) |
| InChIKey | OKDCCNMSJHVFRV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|