C29H23F3N4O3 — CID 67384218
2-[(4-pyridin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrimidin-2-ylpropanoic acid (PubChem CID 67384218) has the molecular formula C29H23F3N4O3 and a molecular weight of 532.52 g/mol. Its IUPAC name is 2-[(4-pyridin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrimidin-2-ylpropanoic acid.
| Compound Name | 2-[(4-pyridin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrimidin-2-ylpropanoic acid |
|---|---|
| PubChem CID | 67384218 |
| Molecular Formula | C29H23F3N4O3 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 2-[(4-pyridin-4-ylphenyl)methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]-3-pyrimidin-2-ylpropanoic acid |
| SMILES | O=C(O)C(Cc1ncccn1)N(Cc1ccc(-c2ccncc2)cc1)C(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H23F3N4O3/c30-29(31,32)24-9-4-20(5-10-24)6-11-27(37)36(25(28(38)39)18-26-34-14-1-15-35-26)19-21-2-7-22(8-3-21)23-12-16-33-17-13-23/h1-17,25H,18-19H2,(H,38,39) |
| InChIKey | FJTLVAHVPKPNGD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|