C36H36N8O5 — CID 67385617
N,N-bis[(4-methoxyphenyl)methyl]-5-[2-morpholin-4-yl-7-(3-nitrophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]pyrimidin-2-amine (PubChem CID 67385617) has the molecular formula C36H36N8O5 and a molecular weight of 660.74 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-5-[2-morpholin-4-yl-7-(3-nitrophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]pyrimidin-2-amine.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-5-[2-morpholin-4-yl-7-(3-nitrophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 67385617 |
| Molecular Formula | C36H36N8O5 |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-5-[2-morpholin-4-yl-7-(3-nitrophenyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl]pyrimidin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2ncc(-c3nc(N4CCOCC4)nc4c3CCN4c3cccc([N+](=O)[O-])c3)cn2)cc1 |
| InChI | InChI=1S/C36H36N8O5/c1-47-30-10-6-25(7-11-30)23-42(24-26-8-12-31(48-2)13-9-26)35-37-21-27(22-38-35)33-32-14-15-43(28-4-3-5-29(20-28)44(45)46)34(32)40-36(39-33)41-16-18-49-19-17-41/h3-13,20-22H,14-19,23-24H2,1-2H3 |
| InChIKey | JVHUJKQLYHIBHM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 132.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|