C12H9ClN4 — CID 67388301
2-(3-chlorophenyl)imidazo[1,2-a]pyrimidin-7-amine (PubChem CID 67388301) has the molecular formula C12H9ClN4 and a molecular weight of 244.69 g/mol. Its IUPAC name is 2-(3-chlorophenyl)imidazo[1,2-a]pyrimidin-7-amine.
| Compound Name | 2-(3-chlorophenyl)imidazo[1,2-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 67388301 |
| Molecular Formula | C12H9ClN4 |
| Molecular Weight | 244.69 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(3-chlorophenyl)imidazo[1,2-a]pyrimidin-7-amine |
| SMILES | Nc1ccn2cc(-c3cccc(Cl)c3)nc2n1 |
| InChI | InChI=1S/C12H9ClN4/c13-9-3-1-2-8(6-9)10-7-17-5-4-11(14)16-12(17)15-10/h1-7H,(H2,14,15,16) |
| InChIKey | WEGCYRANTJYRLZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |