C26H25F3N8O2 — CID 67390657
N-[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide (PubChem CID 67390657) has the molecular formula C26H25F3N8O2 and a molecular weight of 538.53 g/mol. Its IUPAC name is N-[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide.
| Compound Name | N-[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 67390657 |
| Molecular Formula | C26H25F3N8O2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | N-[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCn3cnnc3C2)nc1)c1oc(N2CCC(c3ccccc3)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C26H25F3N8O2/c27-26(28,29)23-22(39-25(33-23)35-10-8-18(9-11-35)17-4-2-1-3-5-17)24(38)32-19-6-7-20(30-14-19)36-12-13-37-16-31-34-21(37)15-36/h1-7,14,16,18H,8-13,15H2,(H,32,38) |
| InChIKey | CJXHUKRCFSPBSL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |