C33H32F3N7O5 — CID 67390715
N-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide (PubChem CID 67390715) has the molecular formula C33H32F3N7O5 and a molecular weight of 663.66 g/mol. Its IUPAC name is N-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide.
| Compound Name | N-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 67390715 |
| Molecular Formula | C33H32F3N7O5 |
| Molecular Weight | 663.66 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | N-[6-[4-[2-(2-nitrophenyl)acetyl]piperazin-1-yl]-3-pyridinyl]-2-(4-phenylpiperidin-1-yl)-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)Cc3ccccc3[N+](=O)[O-])CC2)nc1)c1oc(N2CCC(c3ccccc3)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C33H32F3N7O5/c34-33(35,36)30-29(48-32(39-30)42-14-12-23(13-15-42)22-6-2-1-3-7-22)31(45)38-25-10-11-27(37-21-25)40-16-18-41(19-17-40)28(44)20-24-8-4-5-9-26(24)43(46)47/h1-11,21,23H,12-20H2,(H,38,45) |
| InChIKey | XOBVMAAWHBDQLZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|