sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate

C19H13NaO2 — CID 67392194

IUPACsodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate
SMILESO=C([O-])c1ccc(/C=C/c2ccc3ccccc3c2)cc1.[Na+]
InChIInChI=1S/C19H14O2.Na/c20-19(21)17-11-7-14(8-12-17)5-6-15-9-10-16-3-1-2-4-18(16)13-15;/h1-13H,(H,20,21);/q;+1/p-1/b6-5+;
InChIKeyWUIJPGSFBAAHAM-IPZCTEOASA-M
MW296.30 g/mol
LogP0.38
Rot. Bonds3

About sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate

sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate (PubChem CID 67392194) has the molecular formula C19H13NaO2 and a molecular weight of 296.30 g/mol. Its IUPAC name is sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate.

Molecular Properties

Compound Namesodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate
PubChem CID67392194
Molecular FormulaC19H13NaO2
Molecular Weight296.30 g/mol
Exact Mass296.08
IUPAC Namesodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate
SMILESO=C([O-])c1ccc(/C=C/c2ccc3ccccc3c2)cc1.[Na+]
InChIInChI=1S/C19H14O2.Na/c20-19(21)17-11-7-14(8-12-17)5-6-15-9-10-16-3-1-2-4-18(16)13-15;/h1-13H,(H,20,21);/q;+1/p-1/b6-5+;
InChIKeyWUIJPGSFBAAHAM-IPZCTEOASA-M
XLogP0.38
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.30
LogP ≤ 50.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate?
The IUPAC name of sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate (CID 67392194) is sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate.
What is the SMILES notation for sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate?
The canonical SMILES for sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate is O=C([O-])c1ccc(/C=C/c2ccc3ccccc3c2)cc1.[Na+].
What is the InChIKey of sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate?
The InChIKey is WUIJPGSFBAAHAM-IPZCTEOASA-M. The full InChI is InChI=1S/C19H14O2.Na/c20-19(21)17-11-7-14(8-12-17)5-6-15-9-10-16-3-1-2-4-18(16)13-15;/h1-13H,(H,20,21);/q;+1/p-1/b6-5+;.
What are the key properties of sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate?
sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate has a molecular weight of 296.30 g/mol, XLogP of 0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-[(E)-2-naphthalen-2-ylethenyl]benzoate is sourced from PubChem (CID 67392194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).