C22H33N3O3S — CID 67393705
N-[4-(4-cyclobutylpiperazine-1-carbonyl)cyclohexyl]-2-methylbenzenesulfonamide (PubChem CID 67393705) has the molecular formula C22H33N3O3S and a molecular weight of 419.59 g/mol. Its IUPAC name is N-[4-(4-cyclobutylpiperazine-1-carbonyl)cyclohexyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[4-(4-cyclobutylpiperazine-1-carbonyl)cyclohexyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67393705 |
| Molecular Formula | C22H33N3O3S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[4-(4-cyclobutylpiperazine-1-carbonyl)cyclohexyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC1CCC(C(=O)N2CCN(C3CCC3)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O3S/c1-17-5-2-3-8-21(17)29(27,28)23-19-11-9-18(10-12-19)22(26)25-15-13-24(14-16-25)20-6-4-7-20/h2-3,5,8,18-20,23H,4,6-7,9-16H2,1H3 |
| InChIKey | CTKNKMHEUVHBLA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |