C23H34ClN3O — CID 68596509
[4-(3-chloro-4-methylanilino)cyclohexyl]-(4-cyclopentylpiperazin-1-yl)methanone (PubChem CID 68596509) has the molecular formula C23H34ClN3O and a molecular weight of 404.00 g/mol. Its IUPAC name is [4-(3-chloro-4-methylanilino)cyclohexyl]-(4-cyclopentylpiperazin-1-yl)methanone.
| Compound Name | [4-(3-chloro-4-methylanilino)cyclohexyl]-(4-cyclopentylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 68596509 |
| Molecular Formula | C23H34ClN3O |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | [4-(3-chloro-4-methylanilino)cyclohexyl]-(4-cyclopentylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(NC2CCC(C(=O)N3CCN(C4CCCC4)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C23H34ClN3O/c1-17-6-9-20(16-22(17)24)25-19-10-7-18(8-11-19)23(28)27-14-12-26(13-15-27)21-4-2-3-5-21/h6,9,16,18-19,21,25H,2-5,7-8,10-15H2,1H3 |
| InChIKey | NOWZJXVBJJGAMX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |