C23H34FN3O — CID 68596788
(4-cyclopentylpiperazin-1-yl)-[4-[(4-fluorophenyl)methylamino]cyclohexyl]methanone (PubChem CID 68596788) has the molecular formula C23H34FN3O and a molecular weight of 387.54 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-[4-[(4-fluorophenyl)methylamino]cyclohexyl]methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-[4-[(4-fluorophenyl)methylamino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 68596788 |
| Molecular Formula | C23H34FN3O |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-[4-[(4-fluorophenyl)methylamino]cyclohexyl]methanone |
| SMILES | O=C(C1CCC(NCc2ccc(F)cc2)CC1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H34FN3O/c24-20-9-5-18(6-10-20)17-25-21-11-7-19(8-12-21)23(28)27-15-13-26(14-16-27)22-3-1-2-4-22/h5-6,9-10,19,21-22,25H,1-4,7-8,11-17H2 |
| InChIKey | GHCRQLNXEBXNDG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |