About ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate
ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate (PubChem CID 67395238) has the molecular formula C20H23F2NO4
and a molecular weight of 379.40 g/mol. Its IUPAC name is ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate.
Molecular Properties
| Compound Name | ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate |
| PubChem CID | 67395238 |
| Molecular Formula | C20H23F2NO4 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate |
| SMILES | CCOC(=O)c1c(F)cc(NC(=O)c2cc(C(C)C)c(C(C)C)o2)cc1F |
| InChI | InChI=1S/C20H23F2NO4/c1-6-26-20(25)17-14(21)7-12(8-15(17)22)23-19(24)16-9-13(10(2)3)18(27-16)11(4)5/h7-11H,6H2,1-5H3,(H,23,24) |
| InChIKey | QCWVHPDEDJFTDH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate?
The IUPAC name of ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate (CID 67395238) is ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate.
What is the SMILES notation for ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate?
The canonical SMILES for ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate is CCOC(=O)c1c(F)cc(NC(=O)c2cc(C(C)C)c(C(C)C)o2)cc1F.
What is the InChIKey of ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate?
The InChIKey is QCWVHPDEDJFTDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2NO4/c1-6-26-20(25)17-14(21)7-12(8-15(17)22)23-19(24)16-9-13(10(2)3)18(27-16)11(4)5/h7-11H,6H2,1-5H3,(H,23,24).
What are the key properties of ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate?
ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate has a molecular weight of 379.40 g/mol, XLogP of 5.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[4,5-di(propan-2-yl)furan-2-carbonyl]amino]-2,6-difluorobenzoate is sourced from PubChem (CID 67395238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).