About CID 67395266
CID 67395266 (PubChem CID 67395266) has the molecular formula C12H6BCl2F2O
and a molecular weight of 285.89 g/mol.
Molecular Properties
| Compound Name | CID 67395266 |
| PubChem CID | 67395266 |
| Molecular Formula | C12H6BCl2F2O |
| Molecular Weight | 285.89 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | — |
| SMILES | Fc1cc([B]Oc2ccc(Cl)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C12H6BCl2F2O/c14-9-3-1-7(5-11(9)16)13-18-8-2-4-10(15)12(17)6-8/h1-6H |
| InChIKey | VZPSYUMQHCURMQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67395266 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67395266?
The IUPAC name of CID 67395266 (CID 67395266) is not available.
What is the SMILES notation for CID 67395266?
The canonical SMILES for CID 67395266 is Fc1cc([B]Oc2ccc(Cl)c(F)c2)ccc1Cl.
What is the InChIKey of CID 67395266?
The InChIKey is VZPSYUMQHCURMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BCl2F2O/c14-9-3-1-7(5-11(9)16)13-18-8-2-4-10(15)12(17)6-8/h1-6H.
What are the key properties of CID 67395266?
CID 67395266 has a molecular weight of 285.89 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67395266 is sourced from PubChem (CID 67395266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).