About CID 57306206
CID 57306206 (PubChem CID 57306206) has the molecular formula C12H8BCl2O
and a molecular weight of 249.91 g/mol.
Molecular Properties
| Compound Name | CID 57306206 |
| PubChem CID | 57306206 |
| Molecular Formula | C12H8BCl2O |
| Molecular Weight | 249.91 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | — |
| SMILES | Clc1ccc([B]Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C12H8BCl2O/c14-10-3-1-9(2-4-10)13-16-12-7-5-11(15)6-8-12/h1-8H |
| InChIKey | NUFJEZHNUGOJMR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.91 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57306206 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57306206?
The IUPAC name of CID 57306206 (CID 57306206) is not available.
What is the SMILES notation for CID 57306206?
The canonical SMILES for CID 57306206 is Clc1ccc([B]Oc2ccc(Cl)cc2)cc1.
What is the InChIKey of CID 57306206?
The InChIKey is NUFJEZHNUGOJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BCl2O/c14-10-3-1-9(2-4-10)13-16-12-7-5-11(15)6-8-12/h1-8H.
What are the key properties of CID 57306206?
CID 57306206 has a molecular weight of 249.91 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57306206 is sourced from PubChem (CID 57306206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).