C14H8Cl4N2O2 — CID 11326398
(NE,1E)-N-[chloro-(4-chlorophenoxy)methylidene]-1-(4-chlorophenoxy)methanehydrazonoyl chloride (PubChem CID 11326398) has the molecular formula C14H8Cl4N2O2 and a molecular weight of 378.04 g/mol. Its IUPAC name is (NE,1E)-N-[chloro-(4-chlorophenoxy)methylidene]-1-(4-chlorophenoxy)methanehydrazonoyl chloride.
| Compound Name | (NE,1E)-N-[chloro-(4-chlorophenoxy)methylidene]-1-(4-chlorophenoxy)methanehydrazonoyl chloride |
|---|---|
| PubChem CID | 11326398 |
| Molecular Formula | C14H8Cl4N2O2 |
| Molecular Weight | 378.04 g/mol |
| Exact Mass | 375.93 |
| IUPAC Name | (NE,1E)-N-[chloro-(4-chlorophenoxy)methylidene]-1-(4-chlorophenoxy)methanehydrazonoyl chloride |
| SMILES | Cl/C(=N/N=C(/Cl)Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8Cl4N2O2/c15-9-1-5-11(6-2-9)21-13(17)19-20-14(18)22-12-7-3-10(16)4-8-12/h1-8H/b19-13-,20-14- |
| InChIKey | QKHPGUPYHZQDCE-AXPXABNXSA-N |
| XLogP | 5.56 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.04 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|