About (4-chlorophenyl) N'-cyanocarbamimidate
(4-chlorophenyl) N'-cyanocarbamimidate (PubChem CID 12870881) has the molecular formula C8H6ClN3O
and a molecular weight of 195.61 g/mol. Its IUPAC name is (4-chlorophenyl) N'-cyanocarbamimidate.
Molecular Properties
| Compound Name | (4-chlorophenyl) N'-cyanocarbamimidate |
| PubChem CID | 12870881 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | (4-chlorophenyl) N'-cyanocarbamimidate |
| SMILES | N#C/N=C(\N)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H6ClN3O/c9-6-1-3-7(4-2-6)13-8(11)12-5-10/h1-4H,(H2,11,12) |
| InChIKey | XNZYWIKQOBWXIQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) N'-cyanocarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) N'-cyanocarbamimidate?
The IUPAC name of (4-chlorophenyl) N'-cyanocarbamimidate (CID 12870881) is (4-chlorophenyl) N'-cyanocarbamimidate.
What is the SMILES notation for (4-chlorophenyl) N'-cyanocarbamimidate?
The canonical SMILES for (4-chlorophenyl) N'-cyanocarbamimidate is N#C/N=C(\N)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) N'-cyanocarbamimidate?
The InChIKey is XNZYWIKQOBWXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O/c9-6-1-3-7(4-2-6)13-8(11)12-5-10/h1-4H,(H2,11,12).
What are the key properties of (4-chlorophenyl) N'-cyanocarbamimidate?
(4-chlorophenyl) N'-cyanocarbamimidate has a molecular weight of 195.61 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) N'-cyanocarbamimidate is sourced from PubChem (CID 12870881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).