C21H25ClN2O2 — CID 46927856
[2-(4-chlorophenoxy)-1-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methylpropylidene]cyanamide (PubChem CID 46927856) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is [2-(4-chlorophenoxy)-1-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methylpropylidene]cyanamide.
| Compound Name | [2-(4-chlorophenoxy)-1-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methylpropylidene]cyanamide |
|---|---|
| PubChem CID | 46927856 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [2-(4-chlorophenoxy)-1-[(1S,3R)-5-hydroxy-2-adamantyl]-2-methylpropylidene]cyanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)/C(=N\C#N)C1[C@@H]2CC3C[C@H]1CC(O)(C3)C2 |
| InChI | InChI=1S/C21H25ClN2O2/c1-20(2,26-17-5-3-16(22)4-6-17)19(24-12-23)18-14-7-13-8-15(18)11-21(25,9-13)10-14/h3-6,13-15,18,25H,7-11H2,1-2H3/b24-19-/t13?,14-,15+,18?,21? |
| InChIKey | XEBXYAPHVBJLAM-NVUPUZMDSA-N |
| XLogP | 4.61 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|