C20H25ClFNO3 — CID 11682398
2-(2-chloro-4-fluorophenoxy)-N-(5-hydroxy-2-adamantyl)-2-methylpropanamide (PubChem CID 11682398) has the molecular formula C20H25ClFNO3 and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenoxy)-N-(5-hydroxy-2-adamantyl)-2-methylpropanamide.
| Compound Name | 2-(2-chloro-4-fluorophenoxy)-N-(5-hydroxy-2-adamantyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 11682398 |
| Molecular Formula | C20H25ClFNO3 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-(2-chloro-4-fluorophenoxy)-N-(5-hydroxy-2-adamantyl)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(F)cc1Cl)C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C20H25ClFNO3/c1-19(2,26-16-4-3-14(22)7-15(16)21)18(24)23-17-12-5-11-6-13(17)10-20(25,8-11)9-12/h3-4,7,11-13,17,25H,5-6,8-10H2,1-2H3,(H,23,24) |
| InChIKey | NHCHYBNZPYZVHC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |