C21H25NOS — CID 67396351
6-[2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxy-3-methylpyridine (PubChem CID 67396351) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is 6-[2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxy-3-methylpyridine.
| Compound Name | 6-[2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxy-3-methylpyridine |
|---|---|
| PubChem CID | 67396351 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 6-[2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxy-3-methylpyridine |
| SMILES | COc1nc(C(=CC2CCCC2)c2ccc(SC)cc2)ccc1C |
| InChI | InChI=1S/C21H25NOS/c1-15-8-13-20(22-21(15)23-2)19(14-16-6-4-5-7-16)17-9-11-18(24-3)12-10-17/h8-14,16H,4-7H2,1-3H3 |
| InChIKey | ZMYSJGRAOXMMNW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |