C20H22ClNOS — CID 67401232
3-chloro-6-[(E)-2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxypyridine (PubChem CID 67401232) has the molecular formula C20H22ClNOS and a molecular weight of 359.92 g/mol. Its IUPAC name is 3-chloro-6-[(E)-2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxypyridine.
| Compound Name | 3-chloro-6-[(E)-2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxypyridine |
|---|---|
| PubChem CID | 67401232 |
| Molecular Formula | C20H22ClNOS |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-chloro-6-[(E)-2-cyclopentyl-1-(4-methylsulfanylphenyl)ethenyl]-2-methoxypyridine |
| SMILES | COc1nc(/C(=C/C2CCCC2)c2ccc(SC)cc2)ccc1Cl |
| InChI | InChI=1S/C20H22ClNOS/c1-23-20-18(21)11-12-19(22-20)17(13-14-5-3-4-6-14)15-7-9-16(24-2)10-8-15/h7-14H,3-6H2,1-2H3/b17-13+ |
| InChIKey | ATHBTFSHLKSIAG-GHRIWEEISA-N |
| XLogP | 6.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |