C19H21BrClNO — CID 58452814
6-[(E)-3-bromo-1-(4-tert-butylphenyl)prop-1-enyl]-3-chloro-2-methoxypyridine (PubChem CID 58452814) has the molecular formula C19H21BrClNO and a molecular weight of 394.74 g/mol. Its IUPAC name is 6-[(E)-3-bromo-1-(4-tert-butylphenyl)prop-1-enyl]-3-chloro-2-methoxypyridine.
| Compound Name | 6-[(E)-3-bromo-1-(4-tert-butylphenyl)prop-1-enyl]-3-chloro-2-methoxypyridine |
|---|---|
| PubChem CID | 58452814 |
| Molecular Formula | C19H21BrClNO |
| Molecular Weight | 394.74 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 6-[(E)-3-bromo-1-(4-tert-butylphenyl)prop-1-enyl]-3-chloro-2-methoxypyridine |
| SMILES | COc1nc(/C(=C/CBr)c2ccc(C(C)(C)C)cc2)ccc1Cl |
| InChI | InChI=1S/C19H21BrClNO/c1-19(2,3)14-7-5-13(6-8-14)15(11-12-20)17-10-9-16(21)18(22-17)23-4/h5-11H,12H2,1-4H3/b15-11+ |
| InChIKey | BUPNAFUQOFCIGM-RVDMUPIBSA-N |
| XLogP | 5.87 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|