C21H23ClN2OS — CID 77278403
3-chloro-6-[1-(4-cyclopropylsulfanylphenyl)-2-pyrrolidin-3-ylethenyl]-2-methoxypyridine (PubChem CID 77278403) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is 3-chloro-6-[1-(4-cyclopropylsulfanylphenyl)-2-pyrrolidin-3-ylethenyl]-2-methoxypyridine.
| Compound Name | 3-chloro-6-[1-(4-cyclopropylsulfanylphenyl)-2-pyrrolidin-3-ylethenyl]-2-methoxypyridine |
|---|---|
| PubChem CID | 77278403 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-chloro-6-[1-(4-cyclopropylsulfanylphenyl)-2-pyrrolidin-3-ylethenyl]-2-methoxypyridine |
| SMILES | COc1nc(C(=CC2CCNC2)c2ccc(SC3CC3)cc2)ccc1Cl |
| InChI | InChI=1S/C21H23ClN2OS/c1-25-21-19(22)8-9-20(24-21)18(12-14-10-11-23-13-14)15-2-4-16(5-3-15)26-17-6-7-17/h2-5,8-9,12,14,17,23H,6-7,10-11,13H2,1H3 |
| InChIKey | QGBJYOXVUSLLRG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |