C19H24F3N3O4 — CID 67399819
tert-butyl 4-[5-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 67399819) has the molecular formula C19H24F3N3O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is tert-butyl 4-[5-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67399819 |
| Molecular Formula | C19H24F3N3O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl 4-[5-(3-methoxy-3-oxoprop-1-enyl)-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | COC(=O)C=Cc1cnc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H24F3N3O4/c1-18(2,3)29-17(27)25-9-7-24(8-10-25)16-14(19(20,21)22)11-13(12-23-16)5-6-15(26)28-4/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | IKNHJNIHBFTALT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|