C18H17F3N4O4S — CID 67400502
N-[3-[2,2,2-trifluoro-1-(1-oxidopyridin-1-ium-3-yl)ethoxy]quinoxalin-2-yl]propane-1-sulfonamide (PubChem CID 67400502) has the molecular formula C18H17F3N4O4S and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[3-[2,2,2-trifluoro-1-(1-oxidopyridin-1-ium-3-yl)ethoxy]quinoxalin-2-yl]propane-1-sulfonamide.
| Compound Name | N-[3-[2,2,2-trifluoro-1-(1-oxidopyridin-1-ium-3-yl)ethoxy]quinoxalin-2-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 67400502 |
| Molecular Formula | C18H17F3N4O4S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-[3-[2,2,2-trifluoro-1-(1-oxidopyridin-1-ium-3-yl)ethoxy]quinoxalin-2-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1nc2ccccc2nc1OC(c1ccc[n+]([O-])c1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N4O4S/c1-2-10-30(27,28)24-16-17(23-14-8-4-3-7-13(14)22-16)29-15(18(19,20)21)12-6-5-9-25(26)11-12/h3-9,11,15H,2,10H2,1H3,(H,22,24) |
| InChIKey | HNMCZMYHNBFFRA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|