C26H28N2O4 — CID 67406803
methyl 4-[2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]-2-oxoethoxy]benzoate (PubChem CID 67406803) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl 4-[2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]-2-oxoethoxy]benzoate.
| Compound Name | methyl 4-[2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 67406803 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl 4-[2-[3-[[(1R)-1-naphthalen-1-ylethyl]amino]pyrrolidin-1-yl]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)N2CCC(N[C@H](C)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-18(23-9-5-7-19-6-3-4-8-24(19)23)27-21-14-15-28(16-21)25(29)17-32-22-12-10-20(11-13-22)26(30)31-2/h3-13,18,21,27H,14-17H2,1-2H3/t18-,21?/m1/s1 |
| InChIKey | WLFBLCLKCNVTMZ-ITUIMRKVSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |