C11H7BrF3NO — CID 67407533
4-(bromomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 67407533) has the molecular formula C11H7BrF3NO and a molecular weight of 306.08 g/mol. Its IUPAC name is 4-(bromomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 4-(bromomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 67407533 |
| Molecular Formula | C11H7BrF3NO |
| Molecular Weight | 306.08 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 4-(bromomethyl)-2-[3-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | FC(F)(F)c1cccc(-c2nc(CBr)co2)c1 |
| InChI | InChI=1S/C11H7BrF3NO/c12-5-9-6-17-10(16-9)7-2-1-3-8(4-7)11(13,14)15/h1-4,6H,5H2 |
| InChIKey | CMRFFKAWFSWYQA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.08 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|