C12H9BrF3NO — CID 175265096
3-(2-bromoethyl)-5-[3-(trifluoromethyl)phenyl]-1,2-oxazole (PubChem CID 175265096) has the molecular formula C12H9BrF3NO and a molecular weight of 320.11 g/mol. Its IUPAC name is 3-(2-bromoethyl)-5-[3-(trifluoromethyl)phenyl]-1,2-oxazole.
| Compound Name | 3-(2-bromoethyl)-5-[3-(trifluoromethyl)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 175265096 |
| Molecular Formula | C12H9BrF3NO |
| Molecular Weight | 320.11 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 3-(2-bromoethyl)-5-[3-(trifluoromethyl)phenyl]-1,2-oxazole |
| SMILES | FC(F)(F)c1cccc(-c2cc(CCBr)no2)c1 |
| InChI | InChI=1S/C12H9BrF3NO/c13-5-4-10-7-11(18-17-10)8-2-1-3-9(6-8)12(14,15)16/h1-3,6-7H,4-5H2 |
| InChIKey | FROBSAQHDAUXTE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.11 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|