C18H14F3N3O2 — CID 97082942
N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 97082942) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 97082942 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | N/C(=N\OCc1cc(-c2ccccc2)on1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N3O2/c19-18(20,21)14-8-4-7-13(9-14)17(22)24-25-11-15-10-16(26-23-15)12-5-2-1-3-6-12/h1-10H,11H2,(H2,22,24) |
| InChIKey | WCJZHFQPBGEORX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|