C16H16N4O2S — CID 126812144
2-(4-methyl-1,3-thiazol-2-yl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]ethanimidamide (PubChem CID 126812144) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]ethanimidamide.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]ethanimidamide |
|---|---|
| PubChem CID | 126812144 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-N'-[(5-phenyl-1,2-oxazol-3-yl)methoxy]ethanimidamide |
| SMILES | Cc1csc(CC(N)=NOCc2cc(-c3ccccc3)on2)n1 |
| InChI | InChI=1S/C16H16N4O2S/c1-11-10-23-16(18-11)8-15(17)20-21-9-13-7-14(22-19-13)12-5-3-2-4-6-12/h2-7,10H,8-9H2,1H3,(H2,17,20) |
| InChIKey | ZSOJHZUYDDOYJY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|