C45H44N2O2 — CID 67411542
4-[4-[9-[4-(4-amino-2-methylphenoxy)-3-propan-2-ylphenyl]fluoren-9-yl]-2-propan-2-ylphenoxy]-3-methylaniline (PubChem CID 67411542) has the molecular formula C45H44N2O2 and a molecular weight of 644.86 g/mol. Its IUPAC name is 4-[4-[9-[4-(4-amino-2-methylphenoxy)-3-propan-2-ylphenyl]fluoren-9-yl]-2-propan-2-ylphenoxy]-3-methylaniline.
| Compound Name | 4-[4-[9-[4-(4-amino-2-methylphenoxy)-3-propan-2-ylphenyl]fluoren-9-yl]-2-propan-2-ylphenoxy]-3-methylaniline |
|---|---|
| PubChem CID | 67411542 |
| Molecular Formula | C45H44N2O2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 4-[4-[9-[4-(4-amino-2-methylphenoxy)-3-propan-2-ylphenyl]fluoren-9-yl]-2-propan-2-ylphenoxy]-3-methylaniline |
| SMILES | Cc1cc(N)ccc1Oc1ccc(C2(c3ccc(Oc4ccc(N)cc4C)c(C(C)C)c3)c3ccccc3-c3ccccc32)cc1C(C)C |
| InChI | InChI=1S/C45H44N2O2/c1-27(2)37-25-31(15-19-43(37)48-41-21-17-33(46)23-29(41)5)45(39-13-9-7-11-35(39)36-12-8-10-14-40(36)45)32-16-20-44(38(26-32)28(3)4)49-42-22-18-34(47)24-30(42)6/h7-28H,46-47H2,1-6H3 |
| InChIKey | TVZGABGMHDEJBM-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|