C41H36N2O6 — CID 167440366
4-[4-[9-[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]fluoren-9-yl]-2,6-dimethoxyphenoxy]aniline (PubChem CID 167440366) has the molecular formula C41H36N2O6 and a molecular weight of 652.75 g/mol. Its IUPAC name is 4-[4-[9-[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]fluoren-9-yl]-2,6-dimethoxyphenoxy]aniline.
| Compound Name | 4-[4-[9-[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]fluoren-9-yl]-2,6-dimethoxyphenoxy]aniline |
|---|---|
| PubChem CID | 167440366 |
| Molecular Formula | C41H36N2O6 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | 4-[4-[9-[4-(4-aminophenoxy)-3,5-dimethoxyphenyl]fluoren-9-yl]-2,6-dimethoxyphenoxy]aniline |
| SMILES | COc1cc(C2(c3cc(OC)c(Oc4ccc(N)cc4)c(OC)c3)c3ccccc3-c3ccccc32)cc(OC)c1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C41H36N2O6/c1-44-35-21-25(22-36(45-2)39(35)48-29-17-13-27(42)14-18-29)41(33-11-7-5-9-31(33)32-10-6-8-12-34(32)41)26-23-37(46-3)40(38(24-26)47-4)49-30-19-15-28(43)16-20-30/h5-24H,42-43H2,1-4H3 |
| InChIKey | KCTRGRUSEVUSGS-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|