C30H43NO4Si — CID 67412184
methyl (3R)-5-phenylmethoxy-3-[5-tri(propan-2-yl)silyloxy-1H-indol-2-yl]pentanoate (PubChem CID 67412184) has the molecular formula C30H43NO4Si and a molecular weight of 509.76 g/mol. Its IUPAC name is methyl (3R)-5-phenylmethoxy-3-[5-tri(propan-2-yl)silyloxy-1H-indol-2-yl]pentanoate.
| Compound Name | methyl (3R)-5-phenylmethoxy-3-[5-tri(propan-2-yl)silyloxy-1H-indol-2-yl]pentanoate |
|---|---|
| PubChem CID | 67412184 |
| Molecular Formula | C30H43NO4Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | methyl (3R)-5-phenylmethoxy-3-[5-tri(propan-2-yl)silyloxy-1H-indol-2-yl]pentanoate |
| SMILES | COC(=O)C[C@@H](CCOCc1ccccc1)c1cc2cc(O[Si](C(C)C)(C(C)C)C(C)C)ccc2[nH]1 |
| InChI | InChI=1S/C30H43NO4Si/c1-21(2)36(22(3)4,23(5)6)35-27-13-14-28-26(17-27)18-29(31-28)25(19-30(32)33-7)15-16-34-20-24-11-9-8-10-12-24/h8-14,17-18,21-23,25,31H,15-16,19-20H2,1-7H3/t25-/m1/s1 |
| InChIKey | RLGONGIXQTVGGO-RUZDIDTESA-N |
| XLogP | 7.98 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|