C21H26FN6O2+ — CID 67412381
[(3S)-1-[2-amino-6-(4-cyano-3-fluorophenyl)pyrimidin-4-yl]-1-tert-butylpiperidin-1-ium-3-yl]carbamic acid (PubChem CID 67412381) has the molecular formula C21H26FN6O2+ and a molecular weight of 413.48 g/mol. Its IUPAC name is [(3S)-1-[2-amino-6-(4-cyano-3-fluorophenyl)pyrimidin-4-yl]-1-tert-butylpiperidin-1-ium-3-yl]carbamic acid.
| Compound Name | [(3S)-1-[2-amino-6-(4-cyano-3-fluorophenyl)pyrimidin-4-yl]-1-tert-butylpiperidin-1-ium-3-yl]carbamic acid |
|---|---|
| PubChem CID | 67412381 |
| Molecular Formula | C21H26FN6O2+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | [(3S)-1-[2-amino-6-(4-cyano-3-fluorophenyl)pyrimidin-4-yl]-1-tert-butylpiperidin-1-ium-3-yl]carbamic acid |
| SMILES | CC(C)(C)[N+]1(c2cc(-c3ccc(C#N)c(F)c3)nc(N)n2)CCC[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C21H25FN6O2/c1-21(2,3)28(8-4-5-15(12-28)25-20(29)30)18-10-17(26-19(24)27-18)13-6-7-14(11-23)16(22)9-13/h6-7,9-10,15,25H,4-5,8,12H2,1-3H3,(H2-,24,26,27,29,30)/p+1/t15-,28?/m0/s1 |
| InChIKey | CXFQZMUVSQODFC-GKIKDSKJSA-O |
| XLogP | 3.27 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|