C22H28N4O5S — CID 67415740
cyclopentyl (2R)-2-amino-5-[4-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenoxy]pentanoate (PubChem CID 67415740) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is cyclopentyl (2R)-2-amino-5-[4-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenoxy]pentanoate.
| Compound Name | cyclopentyl (2R)-2-amino-5-[4-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 67415740 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | cyclopentyl (2R)-2-amino-5-[4-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]phenoxy]pentanoate |
| SMILES | NC(=O)Nc1sc(-c2ccc(OCCC[C@@H](N)C(=O)OC3CCCC3)cc2)cc1C(N)=O |
| InChI | InChI=1S/C22H28N4O5S/c23-17(21(28)31-15-4-1-2-5-15)6-3-11-30-14-9-7-13(8-10-14)18-12-16(19(24)27)20(32-18)26-22(25)29/h7-10,12,15,17H,1-6,11,23H2,(H2,24,27)(H3,25,26,29)/t17-/m1/s1 |
| InChIKey | VVTWQCJEIMSYLX-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 159.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|