C26H28N4O2 — CID 67415806
3-cyclobutyl-N-(2-methoxyethyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 67415806) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-cyclobutyl-N-(2-methoxyethyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 3-cyclobutyl-N-(2-methoxyethyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 67415806 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-cyclobutyl-N-(2-methoxyethyl)-1-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | COCCNc1nccn2c(C3CCC3)nc(-c3cccc(OCc4ccccc4)c3)c12 |
| InChI | InChI=1S/C26H28N4O2/c1-31-16-14-28-25-24-23(29-26(20-9-5-10-20)30(24)15-13-27-25)21-11-6-12-22(17-21)32-18-19-7-3-2-4-8-19/h2-4,6-8,11-13,15,17,20H,5,9-10,14,16,18H2,1H3,(H,27,28) |
| InChIKey | GFBQKLUKIWDDRV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|