C22H27N3O4 — CID 67416135
2-tert-butyl-4-[4-[(4-hydroxybenzoyl)amino]phenyl]piperazine-1-carboxylic acid (PubChem CID 67416135) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-[(4-hydroxybenzoyl)amino]phenyl]piperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[4-[(4-hydroxybenzoyl)amino]phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67416135 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-tert-butyl-4-[4-[(4-hydroxybenzoyl)amino]phenyl]piperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(c2ccc(NC(=O)c3ccc(O)cc3)cc2)CCN1C(=O)O |
| InChI | InChI=1S/C22H27N3O4/c1-22(2,3)19-14-24(12-13-25(19)21(28)29)17-8-6-16(7-9-17)23-20(27)15-4-10-18(26)11-5-15/h4-11,19,26H,12-14H2,1-3H3,(H,23,27)(H,28,29) |
| InChIKey | BICRPTQXKDTHTQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|