C11H22N2O2 — CID 67417979
(2S)-2,6-diamino-1-(oxan-4-yl)hexan-1-one (PubChem CID 67417979) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-(oxan-4-yl)hexan-1-one.
| Compound Name | (2S)-2,6-diamino-1-(oxan-4-yl)hexan-1-one |
|---|---|
| PubChem CID | 67417979 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2S)-2,6-diamino-1-(oxan-4-yl)hexan-1-one |
| SMILES | NCCCC[C@H](N)C(=O)C1CCOCC1 |
| InChI | InChI=1S/C11H22N2O2/c12-6-2-1-3-10(13)11(14)9-4-7-15-8-5-9/h9-10H,1-8,12-13H2/t10-/m0/s1 |
| InChIKey | XJDBEKXGQFPYBW-JTQLQIEISA-N |
| XLogP | 0.44 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|