C19H14ClNO5S — CID 67420577
2-[(8-benzyl-6-chloro-2-hydroxy-4-oxothiochromene-3-carbonyl)amino]acetic acid (PubChem CID 67420577) has the molecular formula C19H14ClNO5S and a molecular weight of 403.84 g/mol. Its IUPAC name is 2-[(8-benzyl-6-chloro-2-hydroxy-4-oxothiochromene-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(8-benzyl-6-chloro-2-hydroxy-4-oxothiochromene-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 67420577 |
| Molecular Formula | C19H14ClNO5S |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 2-[(8-benzyl-6-chloro-2-hydroxy-4-oxothiochromene-3-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1c(O)sc2c(Cc3ccccc3)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C19H14ClNO5S/c20-12-7-11(6-10-4-2-1-3-5-10)17-13(8-12)16(24)15(19(26)27-17)18(25)21-9-14(22)23/h1-5,7-8,26H,6,9H2,(H,21,25)(H,22,23) |
| InChIKey | VLWSYOJUGKBEEM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |