C14H20N2O2 — CID 67422157
1-methoxy-N-methyl-N-phenylpiperidine-3-carboxamide (PubChem CID 67422157) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-methoxy-N-methyl-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-methoxy-N-methyl-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 67422157 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 1-methoxy-N-methyl-N-phenylpiperidine-3-carboxamide |
| SMILES | CON1CCCC(C(=O)N(C)c2ccccc2)C1 |
| InChI | InChI=1S/C14H20N2O2/c1-15(13-8-4-3-5-9-13)14(17)12-7-6-10-16(11-12)18-2/h3-5,8-9,12H,6-7,10-11H2,1-2H3 |
| InChIKey | QWYBCTHMHPESRY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |