C12H20O5 — CID 67422770
2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid (PubChem CID 67422770) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid.
| Compound Name | 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 67422770 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid |
| SMILES | COC(CC1C(=O)CCC1C(C)C(=O)O)OC |
| InChI | InChI=1S/C12H20O5/c1-7(12(14)15)8-4-5-10(13)9(8)6-11(16-2)17-3/h7-9,11H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | APLYVVHJQVIQQT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|