C24H26F4N4O3 — CID 67424492
N-[2-[azetidin-3-yl-[4-(6-fluoro-3-pyridinyl)-4-hydroxycyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 67424492) has the molecular formula C24H26F4N4O3 and a molecular weight of 494.49 g/mol. Its IUPAC name is N-[2-[azetidin-3-yl-[4-(6-fluoro-3-pyridinyl)-4-hydroxycyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[azetidin-3-yl-[4-(6-fluoro-3-pyridinyl)-4-hydroxycyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67424492 |
| Molecular Formula | C24H26F4N4O3 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[2-[azetidin-3-yl-[4-(6-fluoro-3-pyridinyl)-4-hydroxycyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N(C1CCC(O)(c2ccc(F)nc2)CC1)C1CNC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H26F4N4O3/c25-20-5-4-17(11-30-20)23(35)8-6-18(7-9-23)32(19-12-29-13-19)21(33)14-31-22(34)15-2-1-3-16(10-15)24(26,27)28/h1-5,10-11,18-19,29,35H,6-9,12-14H2,(H,31,34) |
| InChIKey | ZLVZGNYLSPVPGU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|