About (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid
(2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid (PubChem CID 67425595) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid.
Analyze (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid (CID 67425595) is (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid is N[C@@H](CC1CN=CN1)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid?
The InChIKey is RYPMHSMPLYHQOR-AKGZTFGVSA-N. The full InChI is InChI=1S/C6H11N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h3-5H,1-2,7H2,(H,8,9)(H,10,11)/t4?,5-/m0/s1.
What are the key properties of (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid?
(2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid has a molecular weight of 157.17 g/mol, XLogP of -1.21, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(4,5-dihydro-1H-imidazol-5-yl)propanoic acid is sourced from PubChem (CID 67425595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).