C20H20N2OS — CID 67425707
3-[[6-(1-benzothiophen-5-yl)-3-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane (PubChem CID 67425707) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-[[6-(1-benzothiophen-5-yl)-3-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-[[6-(1-benzothiophen-5-yl)-3-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 67425707 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-[[6-(1-benzothiophen-5-yl)-3-pyridinyl]oxy]-8-azabicyclo[3.2.1]octane |
| SMILES | c1cc2cc(-c3ccc(OC4CC5CCC(C4)N5)cn3)ccc2s1 |
| InChI | InChI=1S/C20H20N2OS/c1-6-20-14(7-8-24-20)9-13(1)19-5-4-17(12-21-19)23-18-10-15-2-3-16(11-18)22-15/h1,4-9,12,15-16,18,22H,2-3,10-11H2 |
| InChIKey | QCVYSZURQFMNIV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |